CAS 119309-02-3
:Atalantoflavone
Description:
Atalantoflavone is a naturally occurring flavonoid compound, primarily derived from various plant sources, particularly those in the genus *Ginkgo*. It belongs to the class of flavonoids known as biflavonoids, which are characterized by the presence of two flavonoid units linked together. Atalantoflavone exhibits a range of biological activities, including antioxidant, anti-inflammatory, and potential anticancer properties, making it of interest in pharmacological research. Its structure typically features multiple hydroxyl groups, contributing to its reactivity and ability to scavenge free radicals. Additionally, Atalantoflavone may interact with various biological pathways, influencing cellular processes and signaling. The compound's solubility and stability can vary depending on environmental conditions, which is crucial for its bioavailability and efficacy in therapeutic applications. As research continues, the full spectrum of its pharmacological potential and mechanisms of action is being explored, highlighting its significance in natural product chemistry and medicinal applications.
Formula:C20H16O5
InChI:InChI=1S/C20H16O5/c1-20(2)8-7-13-17(25-20)10-15(23)18-14(22)9-16(24-19(13)18)11-3-5-12(21)6-4-11/h3-10,21,23H,1-2H3
InChI key:InChIKey=YEUHAZULDUVZLA-UHFFFAOYSA-N
SMILES:OC=1C2=C(C3=C(C1)OC(C)(C)C=C3)OC(=CC2=O)C4=CC=C(O)C=C4
Synonyms:- 5,4′-Dihydroxy-7,8-(2,2-dimethylpyrano)flavone
- 5-Hydroxy-2-(4-hydroxyphenyl)-8,8-dimethyl-4H,8H-benzo[1,2-b:3,4-b′]dipyran-4-one
- Atalantoflavone
- Limonianin
- 4H,8H-Benzo[1,2-b:3,4-b′]dipyran-4-one, 5-hydroxy-2-(4-hydroxyphenyl)-8,8-dimethyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Atalantoflavone
CAS:<p>Atalantoflavone shows urease inhibitory potential. It displays weak cytotoxic activity against the human Caucasian prostate adenocarcinoma cell line PC-3.</p>Formula:C20H16O5Purity:98%Color and Shape:SolidMolecular weight:336.34Atalantoflavone
CAS:Formula:C20H16O5Purity:95%~99%Color and Shape:Yellow powderMolecular weight:336.343Atalantoflavone
CAS:<p>Atalantoflavone is a biflavonoid compound, which is a type of secondary metabolite primarily derived from various plant sources, including members of the Selaginella family. It exhibits a range of biological activities due to its complex molecular structure and interactions within biological systems. The mode of action of atalantoflavone involves modulation of multiple signaling pathways, including apoptosis induction, anti-inflammatory effects, and the inhibition of specific enzymes that contribute to pathological states. As a result, it acts on cellular processes to exert its pharmacological effects.</p>Formula:C20H16O5Purity:Min. 95%Molecular weight:336.3 g/mol



