CAS 119318-15-9: 3β,24-Dihydroxyolean-12-ene

Description:3β,24-Dihydroxyolean-12-ene is a triterpenoid compound characterized by its specific hydroxyl functional groups located at the 3β and 24 positions on the oleanene skeleton. This compound is part of a larger class of natural products known as saponins, which are often derived from plant sources and exhibit various biological activities. The presence of hydroxyl groups contributes to its solubility in polar solvents and can influence its interaction with biological membranes. Additionally, the oleanene structure is known for its potential pharmacological properties, including anti-inflammatory and anticancer activities. The compound's molecular structure allows it to participate in various biochemical pathways, making it of interest in medicinal chemistry and natural product research. Its CAS number, 119318-15-9, serves as a unique identifier for regulatory and research purposes, facilitating the study and application of this compound in various scientific fields.

Formula:C₃₀H₅₀O₂

InChI:InChI=1S/C30H50O2/c1-25(2)14-15-26(3)16-17-29(6)20(21(26)18-25)8-9-23-27(4)12-11-24(32)28(5,19-31)22(27)10-13-30(23,29)7/h8,21-24,31-32H,9-19H2,1-7H3/t21-,22+,23+,24-,26+,27-,28+,29+,30+/m0/s1

InChI key:InChIKey=NTWLPZMPTFQYQI-FLZFTVBESA-N

SMILES:OCC1(C)C(O)CCC2(C)C3CC=C4C5CC(C)(C)CCC5(C)CCC4(C)C3(C)CCC12

Synonyms:
3β,24-Dihydroxyolean-12-ene
Olean-12-ene-3,23-diol, (3β,4β)-
Olean-12-ene-3β,24-diol
(3β,4β)-Olean-12-ene-3,23-diol

Found 4 products.

Product data	Purity	Price range	Estimated delivery
Olean-12-ene-3,23-diol, (3β,4β)- REF: IN-DA000ILHCAS: 119318-15-9	96.5%	To inquire	Tue 04 Mar 25
Olean-12-ene-3,24-diol REF: TM-TN4703CAS: 119318-15-9	98%	To inquire	Mon 03 Mar 25
Olean-12-ene-3,24-diol REF: BP-SBP01989CAS: 119318-15-9	95%~99%	To inquire	Wed 05 Mar 25
Olean-12-ene-3,24-diol REF: 3D-UEA31815CAS: 119318-15-9	Min. 95%	To inquire	Tue 15 Apr 25