CAS 119318-15-9

3β,24-Dihydroxyolean-12-ene

Description:

3β,24-Dihydroxyolean-12-ene is a triterpenoid compound characterized by its specific hydroxyl functional groups located at the 3β and 24 positions on the oleanene skeleton. This compound is part of a larger class of natural products known as saponins, which are often derived from plant sources and exhibit various biological activities. The presence of hydroxyl groups contributes to its solubility in polar solvents and can influence its interaction with biological membranes. Additionally, the oleanene structure is known for its potential pharmacological properties, including anti-inflammatory and anticancer activities. The compound's molecular structure allows it to participate in various biochemical pathways, making it of interest in medicinal chemistry and natural product research. Its CAS number, 119318-15-9, serves as a unique identifier for regulatory and research purposes, facilitating the study and application of this compound in various scientific fields.

Formula: C₃₀H₅₀O₂

InChI: InChI=1S/C30H50O2/c1-25(2)14-15-26(3)16-17-29(6)20(21(26)18-25)8-9-23-27(4)12-11-24(32)28(5,19-31)22(27)10-13-30(23,29)7/h8,21-24,31-32H,9-19H2,1-7H3/t21-,22+,23+,24-,26+,27-,28+,29+,30+/m0/s1

InChI key: InChIKey=NTWLPZMPTFQYQI-FLZFTVBESA-N

SMILES: C[C@]12[C@@]3(C)C([C@]4([C@@](C)(CC3)CCC(C)(C)C4)[H])=CC[C@@]1([C@]5(C)[C@@](CC2)([C@](CO)(C)[C@@H](O)CC5)[H])[H]

Synonyms:

• 3β,24-Dihydroxyolean-12-ene
• Olean-12-ene-3,23-diol, (3β,4β)-
• Olean-12-ene-3β,24-diol
• (3β,4β)-Olean-12-ene-3,23-diol

Olean-12-ene-3,23-diol, (3β,4β)-

CAS: 119318-15-9

Formula: C₃₀H₅₀O₂

Purity: 96.5%

Molecular weight: 442.7168

Ref: IN-DA000ILH

Olean-12-ene-3,24-diol

CAS: 119318-15-9

Olean-12-ene-3,24-diol is a natural product for research related to life sciences. The catalog number is TN4703 and the CAS number is 119318-15-9.

Formula: C₃₀H₅₀O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 442.72

Ref: TM-TN4703

Olean-12-ene-3,24-diol

CAS: 119318-15-9

Formula: C₃₀H₅₀O₂

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 442.728

Ref: BP-SBP01989

Olean-12-ene-3,24-diol

Controlled Product

CAS: 119318-15-9

Olean-12-ene-3,24-diol is a bioactive triterpenoid compound, which is typically derived from the structural framework of oleanolic acid, found in various plant species. This compound is extracted through processes involving the hydrolysis of plant extracts rich in saponins, predominantly sourced from the leaves and flowers of Oleaceae family plants, among others.

Formula: C₃₀H₅₀O₂

Purity: Min. 95%

Molecular weight: 442.7 g/mol

Ref: 3D-UEA31815