CAS 1193244-94-8

4-Iodo-2-(methylthio)pyridine

Description:

4-Iodo-2-(methylthio)pyridine is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with an iodine atom and a methylthio group. The molecular structure features a six-membered aromatic ring containing one nitrogen atom, which contributes to its basicity and potential reactivity. The iodine substituent enhances the compound's electrophilic properties, making it useful in various chemical reactions, including nucleophilic substitutions. The methylthio group, consisting of a sulfur atom bonded to a methyl group, can influence the compound's solubility and reactivity, often enhancing its nucleophilicity. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its unique combination of functional groups allows for diverse applications in synthetic organic chemistry, including the synthesis of more complex molecules. As with many halogenated compounds, safety precautions should be taken due to potential toxicity and environmental concerns associated with iodine and sulfur-containing compounds.

Formula: C₆H₆INS

InChI: InChI=1S/C6H6INS/c1-9-6-4-5(7)2-3-8-6/h2-4H,1H3

InChI key: InChIKey=BXKGNZLZIDHIFF-UHFFFAOYSA-N

SMILES: S(C)C1=CC(I)=CC=N1

Synonyms:

• 4-Iodo-2-(methylthio)pyridine
• Pyridine, 4-iodo-2-(methylthio)-