CAS 1193244-96-0
:2-Bromo-5-(methylsulfinyl)pyridine
Description:
2-Bromo-5-(methylsulfinyl)pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 2-position and a methylsulfinyl group at the 5-position contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It exhibits moderate polarity due to the electronegative bromine and sulfur atoms, which can influence its solubility in various organic solvents. The methylsulfinyl group introduces a sulfoxide functionality, which can participate in various chemical reactions, including nucleophilic substitutions and oxidation processes. 2-Bromo-5-(methylsulfinyl)pyridine may be utilized in synthetic organic chemistry, particularly in the development of pharmaceuticals or agrochemicals, due to its potential reactivity and ability to serve as a building block for more complex molecules. Safety precautions should be observed when handling this compound, as it may pose health risks typical of halogenated and sulfur-containing organic substances.
Formula:C6H6BrNOS
InChI:InChI=1S/C6H6BrNOS/c1-10(9)5-2-3-6(7)8-4-5/h2-4H,1H3
InChI key:InChIKey=ZVUHIPJSZBEXED-UHFFFAOYSA-N
SMILES:S(C)(=O)C=1C=CC(Br)=NC1
Synonyms:- Pyridine, 2-bromo-5-(methylsulfinyl)-
- 2-Bromo-5-(methylsulfinyl)pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
