
CAS 1193334-88-1
:4-Bromo-1-(2-hydroxy-2-methylpropyl)-2(1H)-pyridinone
Description:
4-Bromo-1-(2-hydroxy-2-methylpropyl)-2(1H)-pyridinone, identified by its CAS number 1193334-88-1, is a chemical compound characterized by its pyridinone structure, which features a bromine substituent and a hydroxyalkyl group. This compound typically exhibits properties associated with both the pyridine and alcohol functional groups, including potential solubility in polar solvents due to the presence of the hydroxyl group. The bromine atom introduces halogen characteristics, which can influence reactivity and stability. The presence of the hydroxy-2-methylpropyl group may enhance its biological activity, making it of interest in medicinal chemistry. Additionally, the compound's structure suggests potential applications in various fields, including pharmaceuticals and agrochemicals, where its unique functional groups could interact with biological systems or serve as intermediates in synthetic pathways. As with many organic compounds, its physical properties such as melting point, boiling point, and spectral characteristics would need to be determined experimentally for precise applications.
Formula:C9H12BrNO2
InChI:InChI=1S/C9H12BrNO2/c1-9(2,13)6-11-4-3-7(10)5-8(11)12/h3-5,13H,6H2,1-2H3
InChI key:InChIKey=SOYONLZOCIYKPH-UHFFFAOYSA-N
SMILES:C(C(C)(C)O)N1C(=O)C=C(Br)C=C1
Synonyms:- 2(1H)-Pyridinone, 4-bromo-1-(2-hydroxy-2-methylpropyl)-
- 4-Bromo-1-(2-hydroxy-2-methylpropyl)-2(1H)-pyridinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.