CAS 1193386-44-5
:β-Amino-2-chloro-6-fluoro-N-methylbenzenepropanamide
Description:
β-Amino-2-chloro-6-fluoro-N-methylbenzenepropanamide is a chemical compound characterized by its unique structural features, which include an amino group, a chloro substituent, and a fluoro group attached to a benzene ring. This compound is classified as an amide due to the presence of the amide functional group, which is formed by the reaction of an amine with a carboxylic acid. The presence of halogen atoms, specifically chlorine and fluorine, contributes to its potential reactivity and biological activity. The N-methyl group indicates that there is a methyl substitution on the nitrogen atom, which can influence the compound's solubility and interaction with biological systems. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its specific applications and behavior would depend on its interaction with biological targets, as well as its stability and reactivity under various conditions. As with many chemical substances, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C10H12ClFN2O
InChI:InChI=1S/C10H12ClFN2O/c1-14-9(15)5-8(13)10-6(11)3-2-4-7(10)12/h2-4,8H,5,13H2,1H3,(H,14,15)
InChI key:InChIKey=WJIHCGUHCBAXFN-UHFFFAOYSA-N
SMILES:C(CC(NC)=O)(N)C1=C(Cl)C=CC=C1F
Synonyms:- Benzenepropanamide, β-amino-2-chloro-6-fluoro-N-methyl-
- β-Amino-2-chloro-6-fluoro-N-methylbenzenepropanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-Amino-3-(2-chloro-6-fluorophenyl)-N-methylpropanamide
CAS:Formula:C10H12ClFN2OMolecular weight:230.6665
