CymitQuimica logo

CAS 1193386-52-5

:

Ethyl 1-(5-chloro-2-benzoxazolyl)-4-piperidinecarboxylate

Description:
Ethyl 1-(5-chloro-2-benzoxazolyl)-4-piperidinecarboxylate is a chemical compound characterized by its complex structure, which includes a piperidine ring and a benzoxazole moiety. The presence of the chloro substituent on the benzoxazole ring contributes to its unique reactivity and potential biological activity. This compound is typically classified as an ester due to the ethyl group attached to the carboxylate functional group. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar frameworks often exhibit interesting pharmacological properties. The compound's solubility, stability, and reactivity can vary depending on the specific conditions and solvents used. Additionally, the presence of halogen atoms, such as chlorine, can influence its interaction with biological targets, making it a subject of interest in drug discovery and development. Safety and handling precautions should be observed, as with any chemical substance, particularly those with potential biological activity.
Formula:C15H17ClN2O3
InChI:InChI=1S/C15H17ClN2O3/c1-2-20-14(19)10-5-7-18(8-6-10)15-17-12-9-11(16)3-4-13(12)21-15/h3-4,9-10H,2,5-8H2,1H3
InChI key:InChIKey=UKGWPSXLRJPKIP-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1CCN(C=2OC=3C(N2)=CC(Cl)=CC3)CC1
Synonyms:
  • Ethyl 1-(5-chloro-2-benzoxazolyl)-4-piperidinecarboxylate
  • 4-Piperidinecarboxylic acid, 1-(5-chloro-2-benzoxazolyl)-, ethyl ester
  • Ethyl 1-(5-chloro-1,3-benzoxazol-2-yl)piperidine-4-carboxylate
  • ethyl 1-(5-chlorobenzo[d]oxazol-2-yl)piperidine-4-carboxylate
Found 2 products.