CAS 1193387-09-5

2,5-Pyrrolidinedione, 1-[2-(1-piperazinyl)ethyl]-, hydrochloride (1:2)

Description:

2,5-Pyrrolidinedione, 1-[2-(1-piperazinyl)ethyl]-, hydrochloride (1:2) is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a piperazine moiety. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, making it suitable for diverse applications in pharmaceutical and biochemical research. The presence of the hydrochloride indicates that it is a salt form, which often enhances its stability and solubility. The compound may exhibit biological activity, potentially acting as a ligand or modulator in various biochemical pathways, although specific pharmacological properties would require further investigation. Its molecular structure suggests potential interactions with biological targets, which could be of interest in drug development. As with many chemical substances, safety data should be reviewed to understand its handling, toxicity, and environmental impact. Overall, this compound represents a class of substances that may have significant implications in medicinal chemistry and therapeutic applications.

Formula: C₁₀H₁₇N₃O₂·2ClH

InChI: InChI=1S/C10H17N3O2.2ClH/c14-9-1-2-10(15)13(9)8-7-12-5-3-11-4-6-12;;/h11H,1-8H2;2*1H

InChI key: InChIKey=ZZHXRQOVMXORJY-UHFFFAOYSA-N

SMILES: C(CN1CCNCC1)N2C(=O)CCC2=O.Cl

Synonyms:

• 2,5-Pyrrolidinedione, 1-[2-(1-piperazinyl)ethyl]-, hydrochloride (1:2)

1-[2-(Piperazin-1-yl)ethyl]pyrrolidine-2,5-dione dihydrochloride

CAS: 1193387-09-5

Versatile small molecule scaffold

Formula: C₁₀H₁₉Cl₂N₃O₂

Purity: Min. 95%

Molecular weight: 284.18 g/mol

Ref: 3D-TXB38709