CymitQuimica logo

CAS 1193387-14-2

:

Tetrahydro-2-phenyl-2H-pyran-3-carboxylic acid

Description:
Tetrahydro-2-phenyl-2H-pyran-3-carboxylic acid is a chemical compound characterized by its unique bicyclic structure, which includes a pyran ring fused with a phenyl group. This compound typically exhibits properties associated with carboxylic acids, such as the ability to form hydrogen bonds due to the presence of the carboxyl functional group. It is likely to be a solid at room temperature, with moderate solubility in polar solvents like water and higher solubility in organic solvents. The presence of the phenyl group contributes to its aromatic characteristics, potentially influencing its reactivity and interactions with other molecules. This compound may be of interest in various fields, including medicinal chemistry and organic synthesis, due to its potential biological activity and utility as a building block in the synthesis of more complex molecules. As with many organic compounds, its stability and reactivity can be influenced by factors such as pH, temperature, and the presence of other functional groups.
Formula:C12H14O3
InChI:InChI=1S/C12H14O3/c13-12(14)10-7-4-8-15-11(10)9-5-2-1-3-6-9/h1-3,5-6,10-11H,4,7-8H2,(H,13,14)
InChI key:InChIKey=PLTXACXZZGZCLU-UHFFFAOYSA-N
SMILES:C(O)(=O)C1C(OCCC1)C2=CC=CC=C2
Synonyms:
  • 2-Phenyltetrahydropyran-3-carboxylicacid
  • Tetrahydro-2-phenyl-2H-pyran-3-carboxylic acid
  • 2H-Pyran-3-carboxylic acid, tetrahydro-2-phenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.