CAS 1193387-19-7

Acetamide, N-(3-amino-2,6-dimethylphenyl)-, hydrochloride (1:1)

Description:

Acetamide, N-(3-amino-2,6-dimethylphenyl)-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is derived from acetic acid and an amino-substituted aromatic ring. This compound features a 3-amino-2,6-dimethylphenyl moiety, indicating the presence of an amino group attached to a benzene ring that has two methyl groups at the 2 and 6 positions. The hydrochloride form suggests that the compound is a salt formed with hydrochloric acid, enhancing its solubility in water and potentially influencing its biological activity. Typically, such compounds may exhibit properties relevant to medicinal chemistry, including potential applications in pharmaceuticals due to their ability to interact with biological targets. The presence of the amino group may also suggest basicity, while the acetamide structure can contribute to hydrogen bonding capabilities. Overall, this compound's characteristics make it of interest in various fields, including organic synthesis and drug development.

Formula: C₁₀H₁₄N₂O·ClH

InChI: InChI=1S/C10H14N2O.ClH/c1-6-4-5-9(11)7(2)10(6)12-8(3)13;/h4-5H,11H2,1-3H3,(H,12,13);1H

InChI key: InChIKey=OLBHDKBIMWJSNI-UHFFFAOYSA-N

SMILES: N(C(C)=O)C1=C(C)C(N)=CC=C1C.Cl

Synonyms:

• Acetamide, N-(3-amino-2,6-dimethylphenyl)-, hydrochloride (1:1)

N-(3-Amino-2,6-dimethylphenyl)acetamide hydrochloride

CAS: 1193387-19-7

Versatile small molecule scaffold

Formula: C₁₀H₁₅ClN₂O

Purity: Min. 95%

Molecular weight: 214.69 g/mol

Ref: 3D-TXB38719