CAS 1193387-22-2

6-Quinazolinamine, 5,6,7,8-tetrahydro-2-phenyl-, hydrochloride (1:1)

Description:

6-Quinazolinamine, 5,6,7,8-tetrahydro-2-phenyl-, hydrochloride (1:1) is a chemical compound characterized by its quinazoline core structure, which is a bicyclic compound containing a fused benzene and pyrimidine ring. This substance typically exhibits properties associated with its amine functional group, such as basicity and the ability to form salts, as indicated by its hydrochloride form. The tetrahydro configuration suggests that the compound has undergone partial hydrogenation, resulting in a saturated structure that may influence its reactivity and biological activity. The presence of a phenyl group enhances its lipophilicity, potentially affecting its pharmacokinetic properties. This compound may be of interest in medicinal chemistry due to its structural features, which could confer specific biological activities, including potential therapeutic effects. As with many quinazoline derivatives, it may interact with various biological targets, making it a candidate for further research in drug development. Safety and handling precautions should be observed, as with all chemical substances, particularly those with biological activity.

Formula: C₁₄H₁₅N₃·ClH

InChI: InChI=1S/C14H15N3.ClH/c15-12-6-7-13-11(8-12)9-16-14(17-13)10-4-2-1-3-5-10;/h1-5,9,12H,6-8,15H2;1H

InChI key: InChIKey=LDSBRRCELOUEEI-UHFFFAOYSA-N

SMILES: NC1CC=2C(=NC(=NC2)C3=CC=CC=C3)CC1.Cl

Synonyms:

• 6-Quinazolinamine, 5,6,7,8-tetrahydro-2-phenyl-, hydrochloride (1:1)