CAS 1193387-29-9

2-Pyrrolidinone, 1-(2-aminopropyl)-, hydrochloride (1:1)

Description:

2-Pyrrolidinone, 1-(2-aminopropyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidinone structure, which features a five-membered lactam ring. This compound is a hydrochloride salt, indicating that it is the hydrochloric acid salt of the base form, which enhances its solubility in water and makes it suitable for various applications, particularly in pharmaceuticals. The presence of the 2-aminopropyl group suggests that it may exhibit properties related to amine functionality, such as basicity and potential reactivity with electrophiles. This compound may be utilized in medicinal chemistry, potentially as an intermediate in the synthesis of bioactive molecules or as a pharmacological agent. Its specific properties, such as melting point, boiling point, and solubility, would depend on the conditions and purity of the sample. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential hazards associated with amines and hydrochlorides.

Formula: C₇H₁₄N₂O·ClH

InChI: InChI=1S/C7H14N2O.ClH/c1-6(8)5-9-4-2-3-7(9)10;/h6H,2-5,8H2,1H3;1H

InChI key: InChIKey=AKSIZVWNUAUHNS-UHFFFAOYSA-N

SMILES: C(C(C)N)N1C(=O)CCC1.Cl

Synonyms:

• 2-Pyrrolidinone, 1-(2-aminopropyl)-, hydrochloride (1:1)