CAS 1193387-56-2

3-Ethoxy-4-(2,2,2-trifluoroethoxy)benzeneethanethioamide

Description:

3-Ethoxy-4-(2,2,2-trifluoroethoxy)benzeneethanethioamide, identified by its CAS number 1193387-56-2, is a chemical compound that features a complex structure incorporating both ethoxy and trifluoroethoxy functional groups attached to a benzene ring. This compound is characterized by its aromatic nature due to the presence of the benzene moiety, which contributes to its stability and potential reactivity. The ethoxy group enhances its solubility in organic solvents, while the trifluoroethoxy group introduces significant electronegativity, potentially affecting the compound's polarity and reactivity. The thioamide functional group suggests that the compound may exhibit properties typical of amides, such as hydrogen bonding capabilities, which can influence its boiling point and solubility. Additionally, the presence of fluorine atoms can impart unique chemical properties, including increased lipophilicity and potential biological activity. Overall, this compound's characteristics make it of interest in various fields, including pharmaceuticals and materials science, where its unique functional groups can be leveraged for specific applications.

Formula: C₁₂H₁₄F₃NO₂S

InChI: InChI=1S/C12H14F3NO2S/c1-2-17-10-5-8(6-11(16)19)3-4-9(10)18-7-12(13,14)15/h3-5H,2,6-7H2,1H3,(H2,16,19)

InChI key: InChIKey=GJNUJDOJMGRXDV-UHFFFAOYSA-N

SMILES: O(CC(F)(F)F)C1=C(OCC)C=C(CC(N)=S)C=C1

Synonyms:

• 3-Ethoxy-4-(2,2,2-trifluoroethoxy)benzeneethanethioamide
• Benzeneethanethioamide, 3-ethoxy-4-(2,2,2-trifluoroethoxy)-