CAS 1193387-58-4
:Methyl 8-chloro-1,2,4-triazolo[4,3-a]pyridine-3-carboxylate
Description:
Methyl 8-chloro-1,2,4-triazolo[4,3-a]pyridine-3-carboxylate is a chemical compound characterized by its unique triazole and pyridine ring structures, which contribute to its potential biological activity. This compound features a chloro substituent at the 8-position of the triazole ring and a carboxylate ester functional group, which can influence its solubility and reactivity. The presence of the methyl ester enhances its lipophilicity, potentially affecting its pharmacokinetic properties. The triazole moiety is known for its role in various medicinal applications, including antifungal and anticancer activities. Additionally, the compound's structural features may allow for interactions with biological targets, making it of interest in pharmaceutical research. Its CAS number, 1193387-58-4, provides a unique identifier for regulatory and safety information. Overall, Methyl 8-chloro-1,2,4-triazolo[4,3-a]pyridine-3-carboxylate represents a class of compounds that may exhibit significant biological properties, warranting further investigation in medicinal chemistry.
Formula:C8H6ClN3O2
InChI:InChI=1S/C8H6ClN3O2/c1-14-8(13)7-11-10-6-5(9)3-2-4-12(6)7/h2-4H,1H3
InChI key:InChIKey=MBKKPCXIZBJLNO-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1N2C(=NN1)C(Cl)=CC=C2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.