CAS 1193387-61-9

2-Thiophenemethanamine, α-(1-ethylpropyl)-, hydrochloride (1:1)

Description:

2-Thiophenemethanamine, α-(1-ethylpropyl)-, hydrochloride (1:1) is a chemical compound characterized by its thiophene ring structure, which contributes to its aromatic properties and potential biological activity. The presence of the amine functional group indicates that it can participate in various chemical reactions, including nucleophilic substitutions and protonation, which is relevant for its hydrochloride salt form. This compound is likely to exhibit moderate solubility in polar solvents due to the presence of the hydrochloride, enhancing its stability and reactivity in aqueous environments. Its structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting neurological or psychiatric conditions, given the role of thiophene derivatives in medicinal chemistry. Additionally, the ethylpropyl substituent may influence its lipophilicity and bioavailability. As with many amines, it may also exhibit basic properties, allowing it to interact with acids and other electrophiles. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential biological activity.

Formula: C₁₀H₁₇NS·ClH

InChI: InChI=1S/C10H17NS.ClH/c1-3-8(4-2)10(11)9-6-5-7-12-9;/h5-8,10H,3-4,11H2,1-2H3;1H

InChI key: InChIKey=PPHVWTQNTNGRKS-UHFFFAOYSA-N

SMILES: C(C(CC)CC)(N)C1=CC=CS1.Cl

Synonyms:

• 2-Thiophenemethanamine, α-(1-ethylpropyl)-, hydrochloride (1:1)