CAS 1193387-62-0

2,5-Dimethylpyrazolo[1,5-a]pyrimidine-7-methanamine

Description:

2,5-Dimethylpyrazolo[1,5-a]pyrimidine-7-methanamine is a heterocyclic organic compound characterized by its unique pyrazolo-pyrimidine structure, which incorporates both pyrazole and pyrimidine rings. This compound features two methyl groups at the 2 and 5 positions of the pyrazole ring and a methanamine substituent at the 7 position of the pyrimidine ring. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amine functional group. The compound is of interest in medicinal chemistry, potentially serving as a scaffold for the development of pharmaceuticals, particularly in the context of targeting specific biological pathways. Its molecular structure suggests potential interactions with biological receptors, making it a candidate for further research in drug discovery. As with many heterocycles, the compound may exhibit interesting electronic properties and reactivity, which can be explored in various chemical reactions or applications in materials science.

Formula: C₉H₁₂N₄

InChI: InChI=1S/C9H12N4/c1-6-3-8(5-10)13-9(11-6)4-7(2)12-13/h3-4H,5,10H2,1-2H3

InChI key: InChIKey=WBMDTOVVOVQRMF-UHFFFAOYSA-N

SMILES: C(N)C=1N2C(N=C(C)C1)=CC(C)=N2

Synonyms:

• Pyrazolo[1,5-a]pyrimidine-7-methanamine, 2,5-dimethyl-
• 2,5-Dimethylpyrazolo[1,5-a]pyrimidine-7-methanamine