CAS 1193387-66-4

N-[3-(1-Chloroethyl)phenyl]benzamide

Description:

N-[3-(1-Chloroethyl)phenyl]benzamide is an organic compound characterized by its amide functional group, which is linked to a phenyl ring and a chloroethyl substituent. The presence of the chloroethyl group introduces both hydrophobic and electrophilic characteristics, potentially influencing its reactivity and interactions with biological systems. This compound may exhibit moderate solubility in organic solvents, while its solubility in water could be limited due to the hydrophobic nature of the phenyl rings. The structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the chloroethyl moiety can serve as a reactive site for further chemical modifications. Additionally, the compound's molecular structure may impart specific biological activities, making it of interest for research in areas such as drug design or agrochemicals. Safety and handling precautions should be observed, as compounds containing chlorine can pose environmental and health risks. Overall, N-[3-(1-Chloroethyl)phenyl]benzamide represents a versatile structure for further exploration in various chemical and biological contexts.

Formula: C₁₅H₁₄ClNO

InChI: InChI=1S/C15H14ClNO/c1-11(16)13-8-5-9-14(10-13)17-15(18)12-6-3-2-4-7-12/h2-11H,1H3,(H,17,18)

InChI key: InChIKey=ATEMNULTFOKGAG-UHFFFAOYSA-N

SMILES: N(C(=O)C1=CC=CC=C1)C2=CC(C(C)Cl)=CC=C2

Synonyms:

• Benzamide, N-[3-(1-chloroethyl)phenyl]-
• N-[3-(1-Chloroethyl)phenyl]benzamide