CAS 1193387-68-6

1H-Pyrazole-3-propanamine, 5-(4-fluorophenyl)-N,1-dimethyl-, hydrochloride (1:2)

Description:

1H-Pyrazole-3-propanamine, 5-(4-fluorophenyl)-N,1-dimethyl-, hydrochloride (1:2) is a chemical compound characterized by its pyrazole core, which is a five-membered aromatic ring containing two nitrogen atoms. This compound features a propanamine side chain and a 4-fluorophenyl group, indicating the presence of a fluorine substituent on the phenyl ring, which can influence its biological activity and lipophilicity. The hydrochloride form suggests that the compound is a salt, enhancing its solubility in water and potentially affecting its pharmacokinetic properties. The presence of dimethyl groups on the nitrogen atom may contribute to its steric and electronic properties, influencing interactions with biological targets. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, where modifications to the pyrazole structure can lead to varied pharmacological effects. As with many such compounds, safety and handling precautions are essential due to potential toxicity or reactivity.

Formula: C₁₄H₁₈FN₃·2ClH

InChI: InChI=1S/C14H18FN3.2ClH/c1-16-9-3-4-13-10-14(18(2)17-13)11-5-7-12(15)8-6-11;;/h5-8,10,16H,3-4,9H2,1-2H3;2*1H

InChI key: InChIKey=PNEPPPUJTKOXNE-UHFFFAOYSA-N

SMILES: CN1C(=CC(CCCNC)=N1)C2=CC=C(F)C=C2.Cl

Synonyms:

• 1H-Pyrazole-3-propanamine, 5-(4-fluorophenyl)-N,1-dimethyl-, hydrochloride (1:2)

{3-[5-(4-Fluorophenyl)-1-methyl-1H-pyrazol-3-yl]propyl}(methyl)amine dihydrochloride

CAS: 1193387-68-6

Versatile small molecule scaffold

Formula: C₁₄H₂₀Cl₂FN₃

Purity: Min. 95%

Molecular weight: 320.2 g/mol

Ref: 3D-TXB38768