CymitQuimica logo

CAS 1193387-82-4

:

5,6,7,8-Tetrahydro-2-methylimidazo[1,2-a]pyridine-3-ethanamine

Description:
5,6,7,8-Tetrahydro-2-methylimidazo[1,2-a]pyridine-3-ethanamine is a heterocyclic organic compound characterized by its fused imidazole and pyridine rings, which contribute to its unique chemical properties. This compound features a tetrahydro structure, indicating the presence of a saturated ring system, and a methyl group at the 2-position of the imidazole ring. The ethanamine functional group introduces an amine, which can participate in hydrogen bonding and influence the compound's reactivity and solubility. Its molecular structure suggests potential biological activity, making it of interest in pharmacological research. The compound may exhibit properties such as moderate polarity, which can affect its interaction with biological systems. Additionally, the presence of nitrogen atoms in the ring structure can contribute to basicity and potential coordination with metal ions. Overall, this compound's unique structural features position it as a candidate for further investigation in medicinal chemistry and related fields.
Formula:C10H17N3
InChI:InChI=1S/C10H17N3/c1-8-9(5-6-11)13-7-3-2-4-10(13)12-8/h2-7,11H2,1H3
InChI key:InChIKey=OVCRFLLKNDXHEC-UHFFFAOYSA-N
SMILES:C(CN)C=1N2C(=NC1C)CCCC2
Synonyms:
  • Imidazo[1,2-a]pyridine-3-ethanamine, 5,6,7,8-tetrahydro-2-methyl-
  • 5,6,7,8-Tetrahydro-2-methylimidazo[1,2-a]pyridine-3-ethanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.