CAS 1193387-87-9

1,3,4-Oxadiazole-2-carboxylic acid, 5-phenyl-, sodium salt (1:1)

Description:

1,3,4-Oxadiazole-2-carboxylic acid, 5-phenyl-, sodium salt (1:1) is a chemical compound characterized by its oxadiazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms and three carbon atoms. This compound features a carboxylic acid functional group, contributing to its acidic properties, and a phenyl group that enhances its aromatic characteristics. As a sodium salt, it is typically more soluble in water compared to its acid form, which can influence its reactivity and bioavailability in various applications. The presence of the oxadiazole moiety suggests potential biological activity, making it of interest in pharmaceutical and agrochemical research. Its unique structure may also impart specific electronic and steric properties, which can be exploited in material science and organic synthesis. Overall, this compound exemplifies the intersection of organic chemistry and medicinal chemistry, with potential applications in drug development and other fields.

Formula: C₉H₇N₂NaO₃

InChI: InChI=1S/C9H6N2O3.Na/c12-9(13)8-11-10-7(14-8)6-4-2-1-3-5-6;/h1-5H,(H,12,13);

InChI key: InChIKey=RLWIXMAMZFQBEA-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1OC(=NN1)C2=CC=CC=C2.[Na]

Synonyms:

• 1,3,4-Oxadiazole-2-carboxylic acid, 5-phenyl-, sodium salt (1:1)
• Sodium 5-Phenyl-1,3,4-oxadiazole-2-carboxylate

Sodium 5-Phenyl-1,3,4-oxadiazole-2-carboxylate

Controlled Product

CAS: 1193387-87-9

Applications sodium 5-phenyl-1,3,4-oxadiazole-2-carboxylate (cas# 1193387-87-9) is a useful research chemical for organic synthesis.
References Laurent, A., et al.: From PCT Int. Appl. (2011), WO 2011098904 A1 20110818

Formula: C₉H₅N₂O₃Na

Color and Shape: Neat

Molecular weight: 212.13

Ref: TR-B526710

Sodium 5-phenyl-1,3,4-oxadiazole-2-carboxylate

CAS: 1193387-87-9

Versatile small molecule scaffold

Formula: C₉H₅N₂NaO₃

Purity: Min. 95%

Molecular weight: 212.14 g/mol

Ref: 3D-TXB38787