CAS 1193387-92-6

Methyl 3-(aminothioxomethyl)-1H-1,2,4-triazole-1-acetate

Description:

Methyl 3-(aminothioxomethyl)-1H-1,2,4-triazole-1-acetate is a chemical compound characterized by its unique structural features, which include a triazole ring and an acetate functional group. This compound typically exhibits properties associated with both heterocyclic compounds and thioamide derivatives, suggesting potential biological activity. The presence of the aminothioxomethyl group may impart specific reactivity and interaction capabilities, making it of interest in medicinal chemistry and agricultural applications. Its molecular structure allows for hydrogen bonding and potential interactions with biological targets, which could be relevant in drug design or as a pesticide. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other substances. As with many triazole derivatives, it may also exhibit antifungal or antimicrobial properties, although specific biological activities would require empirical investigation. Safety and handling considerations are essential, as with any chemical substance, to mitigate risks associated with exposure or environmental impact.

Formula: C₆H₈N₄O₂S

InChI: InChI=1S/C6H8N4O2S/c1-12-4(11)2-10-3-8-6(9-10)5(7)13/h3H,2H2,1H3,(H2,7,13)

InChI key: InChIKey=DTGUVNAYYOPYGT-UHFFFAOYSA-N

SMILES: C(C(OC)=O)N1N=C(C(N)=S)N=C1

Synonyms:

• Methyl 3-(aminothioxomethyl)-1H-1,2,4-triazole-1-acetate
• 1H-1,2,4-Triazole-1-acetic acid, 3-(aminothioxomethyl)-, methyl ester

Methyl 2-(3-carbamothioyl-1H-1,2,4-triazol-1-yl)acetate

CAS: 1193387-92-6

Methyl 2-(3-carbamothioyl-1H-1,2,4-triazol-1-yl)acetate

Purity: 95%

Molecular weight: 200.22g/mol

Ref: 54-OR1053539