CAS 1193387-94-8

1,2,3,4-Tetrahydro-2-(phenylsulfonyl)-1-isoquinolinemethanamine

Description:

1,2,3,4-Tetrahydro-2-(phenylsulfonyl)-1-isoquinolinemethanamine is a chemical compound characterized by its complex structure, which includes a tetrahydroisoquinoline core and a phenylsulfonyl group. This compound typically exhibits properties associated with both amines and sulfonyl groups, such as potential basicity and reactivity towards electrophiles. The presence of the tetrahydroisoquinoline moiety suggests that it may exhibit biological activity, potentially interacting with various receptors or enzymes in biological systems. Its sulfonyl group can enhance solubility and stability, making it a candidate for pharmaceutical applications. The compound's molecular structure may allow for various functionalizations, which could be explored for developing derivatives with improved efficacy or selectivity. Additionally, the compound's CAS number, 1193387-94-8, serves as a unique identifier for regulatory and research purposes, facilitating its study in chemical databases and literature. Overall, this compound represents a significant interest in medicinal chemistry and drug development due to its unique structural features and potential biological activities.

Formula: C₁₆H₁₈N₂O₂S

InChI: InChI=1S/C16H18N2O2S/c17-12-16-15-9-5-4-6-13(15)10-11-18(16)21(19,20)14-7-2-1-3-8-14/h1-9,16H,10-12,17H2

InChI key: InChIKey=FADDLBKJTNUMJA-UHFFFAOYSA-N

SMILES: S(=O)(=O)(N1C(CN)C=2C(CC1)=CC=CC2)C3=CC=CC=C3

Synonyms:

• 1,2,3,4-Tetrahydro-2-(phenylsulfonyl)-1-isoquinolinemethanamine
• 1-Isoquinolinemethanamine, 1,2,3,4-tetrahydro-2-(phenylsulfonyl)-