CAS 1193388-00-9

1,6-Naphthyridine, 5,6,7,8-tetrahydro-, ethanedioate (1:1)

Description:

1,6-Naphthyridine, 5,6,7,8-tetrahydro-, ethanedioate (1:1) is a chemical compound characterized by its bicyclic structure, which includes a naphthyridine moiety. This compound features a tetrahydro form, indicating the presence of four hydrogen atoms that saturate the ring system, thus enhancing its stability and reactivity. The ethanedioate component suggests the presence of an oxalic acid derivative, which may contribute to its acidic properties and potential for forming salts or complexes. The compound is likely to exhibit polar characteristics due to the presence of functional groups, influencing its solubility in various solvents. Its molecular structure may allow for interactions with biological systems, making it of interest in medicinal chemistry. Additionally, the compound's unique arrangement of atoms may impart specific electronic properties, which could be relevant in applications such as organic synthesis or as a potential ligand in coordination chemistry. Overall, 1,6-Naphthyridine, 5,6,7,8-tetrahydro-, ethanedioate (1:1) presents a combination of structural features that could be explored for various chemical and pharmaceutical applications.

Formula: C₈H₁₀N₂·C₂H₂O₄

InChI: InChI=1S/C8H10N2.C2H2O4/c1-2-7-6-9-5-3-8(7)10-4-1;3-1(4)2(5)6/h1-2,4,9H,3,5-6H2;(H,3,4)(H,5,6)

InChI key: InChIKey=VRVGEVXETNFYNE-UHFFFAOYSA-N

SMILES: C1=2C(CCNC1)=NC=CC2.C(C(O)=O)(O)=O

Synonyms:

• 1,6-Naphthyridine, 5,6,7,8-tetrahydro-, ethanedioate (1:1)