CAS 1193388-02-1

2-Thiophenemethanamine, N-(4-fluorophenyl)-, hydrochloride (1:1)

Description:

2-Thiophenemethanamine, N-(4-fluorophenyl)-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a thiophene ring and an amine functional group. The presence of the 4-fluorophenyl moiety enhances its potential for biological activity, making it of interest in medicinal chemistry. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can facilitate its use in various applications, including pharmaceuticals. The compound may exhibit properties such as being a potential ligand for certain receptors or enzymes, and its fluorinated aromatic ring can influence its pharmacokinetics and pharmacodynamics. Additionally, the thiophene ring contributes to its electronic properties, potentially affecting its reactivity and interaction with biological targets. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Further studies would be necessary to fully elucidate its biological activity and potential therapeutic applications.

Formula: C₁₁H₁₀FNS·ClH

InChI: InChI=1S/C11H10FNS.ClH/c12-9-3-5-10(6-4-9)13-8-11-2-1-7-14-11;/h1-7,13H,8H2;1H

InChI key: InChIKey=ZQEDZDNJYVMSLF-UHFFFAOYSA-N

SMILES: N(CC1=CC=CS1)C2=CC=C(F)C=C2.Cl

Synonyms:

• 2-Thiophenemethanamine, N-(4-fluorophenyl)-, hydrochloride (1:1)