CAS 1193388-03-2
:3-(2,3-Dihydro-2-thioxo-1H-imidazol-1-yl)-N-(2-thienylmethyl)benzamide
Description:
3-(2,3-Dihydro-2-thioxo-1H-imidazol-1-yl)-N-(2-thienylmethyl)benzamide, with the CAS number 1193388-03-2, is a synthetic organic compound characterized by its complex molecular structure, which includes an imidazole ring, a thienyl group, and a benzamide moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity due to the presence of sulfur and nitrogen atoms in its structure. The thioxo group contributes to its reactivity, while the imidazole ring may impart unique pharmacological properties, making it of interest in medicinal chemistry. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. Its potential applications may include use in pharmaceuticals, particularly in the development of agents targeting specific biological pathways. However, detailed studies would be necessary to fully elucidate its characteristics, including its physical properties, biological activity, and potential toxicity.
Formula:C15H13N3OS2
InChI:InChI=1S/C15H13N3OS2/c19-14(17-10-13-5-2-8-21-13)11-3-1-4-12(9-11)18-7-6-16-15(18)20/h1-9H,10H2,(H,16,20)(H,17,19)
InChI key:InChIKey=AAXQDVLYGQKRTG-UHFFFAOYSA-N
SMILES:S=C1N(C2=CC(C(NCC3=CC=CS3)=O)=CC=C2)C=CN1
Synonyms:- 3-(2,3-Dihydro-2-thioxo-1H-imidazol-1-yl)-N-(2-thienylmethyl)benzamide
- Benzamide, 3-(2,3-dihydro-2-thioxo-1H-imidazol-1-yl)-N-(2-thienylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.