CAS 1193388-06-5

1,4-Benzodioxin-6-methanamine, α-cyclopropyl-2,3-dihydro-, hydrochloride (1:1)

Description:

1,4-Benzodioxin-6-methanamine, α-cyclopropyl-2,3-dihydro-, hydrochloride (1:1) is a chemical compound characterized by its unique bicyclic structure, which includes a benzodioxin moiety and an amine functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and interaction with biological systems. The presence of the cyclopropyl group may impart distinctive steric and electronic characteristics, influencing its pharmacological profile. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, enhancing its bioavailability. The compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific receptors or pathways. Its safety and toxicity profile would need to be evaluated through appropriate studies, as with any chemical intended for therapeutic use. Overall, this compound represents a fascinating intersection of organic chemistry and pharmacology, warranting further investigation for potential applications.

Formula: C₁₂H₁₅NO₂·ClH

InChI: InChI=1S/C12H15NO2.ClH/c13-12(8-1-2-8)9-3-4-10-11(7-9)15-6-5-14-10;/h3-4,7-8,12H,1-2,5-6,13H2;1H

InChI key: InChIKey=WNFNACHOWPXSNR-UHFFFAOYSA-N

SMILES: C(N)(C=1C=C2C(=CC1)OCCO2)C3CC3.Cl

Synonyms:

• 1,4-Benzodioxin-6-methanamine, α-cyclopropyl-2,3-dihydro-, hydrochloride (1:1)