CAS 1193388-08-7

Benzenamine, N-ethyl-3-fluoro-, hydrochloride (1:1)

Description:

Benzenamine, N-ethyl-3-fluoro-, hydrochloride (1:1), also known by its CAS number 1193388-08-7, is a chemical compound characterized by its amine functional group and a fluorine atom substituted on the benzene ring. This compound typically appears as a white to off-white solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility compared to the free base. The presence of the ethyl group and the fluorine atom can influence its reactivity and biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. As a hydrochloride salt, it is often used in formulations to improve stability and handling properties. Safety data sheets should be consulted for information on toxicity, handling, and storage, as compounds with amine groups can exhibit varying degrees of biological activity and potential hazards. Overall, this compound's unique structure contributes to its potential applications in chemical synthesis and medicinal chemistry.

Formula: C₈H₁₀FN·ClH

InChI: InChI=1S/C8H10FN.ClH/c1-2-10-8-5-3-4-7(9)6-8;/h3-6,10H,2H2,1H3;1H

InChI key: InChIKey=FVBSHZOBXDMAFY-UHFFFAOYSA-N

SMILES: N(CC)C1=CC(F)=CC=C1.Cl

Synonyms:

• Benzenamine, N-ethyl-3-fluoro-, hydrochloride (1:1)