CAS 1193388-11-2

2-Chloro-N-[2-oxo-2-(1-pyrrolidinyl)ethyl]acetamide

Description:

2-Chloro-N-[2-oxo-2-(1-pyrrolidinyl)ethyl]acetamide is a chemical compound characterized by its unique structure, which includes a chloro substituent and a pyrrolidine moiety. This compound features an acetamide functional group, indicating it has both amide and carbonyl functionalities. The presence of the pyrrolidine ring suggests potential for interactions with biological systems, making it of interest in medicinal chemistry. The chloro group can enhance the compound's reactivity and influence its pharmacological properties. Typically, compounds like this may exhibit properties such as solubility in polar solvents, moderate stability under standard conditions, and potential bioactivity, which could be explored in drug development contexts. Its molecular structure allows for various interactions, including hydrogen bonding and hydrophobic interactions, which are crucial for biological activity. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties and potential applications in pharmaceuticals or other fields.

Formula: C₈H₁₃ClN₂O₂

InChI: InChI=1S/C8H13ClN2O2/c9-5-7(12)10-6-8(13)11-3-1-2-4-11/h1-6H2,(H,10,12)

InChI key: InChIKey=OXFMORMLCANNFF-UHFFFAOYSA-N

SMILES: C(CNC(CCl)=O)(=O)N1CCCC1

Synonyms:

• 2-Chloro-N-[2-oxo-2-(1-pyrrolidinyl)ethyl]acetamide
• Acetamide, 2-chloro-N-[2-oxo-2-(1-pyrrolidinyl)ethyl]-

2-Chloro-N-[2-oxo-2-(pyrrolidin-1-yl)ethyl]acetamide

CAS: 1193388-11-2

2-Chloro-N-[2-oxo-2-(pyrrolidin-1-yl)ethyl]acetamide is a synthetic antibiotic that has been used in the treatment of microbial infections. In vitro studies have shown that this drug inhibits bacterial growth by binding to DNA and RNA. 2-Chloro-N-[2-oxo-2-(pyrrolidin-1-yl)ethyl]acetamide is also active against some viruses and protozoa, including HIV and malaria parasites. This drug binds to ribonucleic acid (RNA) in bacteria and prevents the production of proteins needed for cell division. The chemical structure of 2-Chloro-N-[2-oxo-2-(pyrrolidin-1-yl)ethyl]acetamide is similar to that of erythromycin, which may explain the observed synergistic effects with this drug.

Formula: C₈H₁₃ClN₂O₂

Purity: Min. 95%

Molecular weight: 204.65 g/mol

Ref: 3D-TXB38811