CAS 1193388-17-8

3-Pyridinamine, 2-(1-piperidinyl)-, hydrochloride (1:2)

Description:

3-Pyridinamine, 2-(1-piperidinyl)-, hydrochloride (1:2) is a chemical compound characterized by its pyridine and piperidine moieties, which contribute to its basicity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The presence of the piperidine ring suggests that it may exhibit properties relevant to neuropharmacology, potentially interacting with neurotransmitter systems. The compound's structure indicates it may act as a ligand for various receptors, making it of interest in medicinal chemistry. Its molecular interactions, stability, and reactivity can be influenced by the pH of the environment, and it may exhibit different properties in solid versus solution states. Safety data and handling precautions should be considered, as with any chemical substance, particularly in laboratory or industrial settings. Overall, this compound's unique structural features position it as a candidate for further research in drug development and related fields.

Formula: C₁₀H₁₅N₃·2ClH

InChI: InChI=1S/C10H15N3.2ClH/c11-9-5-4-6-12-10(9)13-7-2-1-3-8-13;;/h4-6H,1-3,7-8,11H2;2*1H

InChI key: InChIKey=RUTHEVZQLKFFRM-UHFFFAOYSA-N

SMILES: NC1=C(N2CCCCC2)N=CC=C1.Cl

Synonyms:

• 3-Pyridinamine, 2-(1-piperidinyl)-, hydrochloride (1:2)

2-(Piperidin-1-yl)pyridin-3-amine dihydrochloride

CAS: 1193388-17-8

Versatile small molecule scaffold

Formula: C₁₀H₁₇Cl₂N₃

Purity: Min. 95%

Molecular weight: 250.17 g/mol

Ref: 3D-TXB38817