CAS 1193388-18-9
:3-Ethoxy-4-(2,2,2-trifluoroethoxy)benzeneacetonitrile
Description:
3-Ethoxy-4-(2,2,2-trifluoroethoxy)benzeneacetonitrile, with the CAS number 1193388-18-9, is a chemical compound characterized by its complex structure that includes an aromatic ring substituted with both ethoxy and trifluoroethoxy groups, as well as a nitrile functional group. This compound is likely to exhibit properties typical of aromatic nitriles, such as moderate polarity and potential solubility in organic solvents. The presence of the trifluoroethoxy group may impart unique electronic and steric effects, influencing its reactivity and interactions with other molecules. Additionally, the ethoxy group can enhance solubility in various organic solvents. The compound may be of interest in pharmaceutical or agrochemical research due to its potential biological activity, although specific biological properties would require empirical investigation. Safety data, including toxicity and environmental impact, should be reviewed before handling, as with any chemical substance. Overall, 3-Ethoxy-4-(2,2,2-trifluoroethoxy)benzeneacetonitrile represents a specialized compound with potential applications in various fields of chemistry.
Formula:C12H12F3NO2
InChI:InChI=1S/C12H12F3NO2/c1-2-17-11-7-9(5-6-16)3-4-10(11)18-8-12(13,14)15/h3-4,7H,2,5,8H2,1H3
InChI key:InChIKey=WBYXSJVUAPIXOE-UHFFFAOYSA-N
SMILES:O(CC(F)(F)F)C1=C(OCC)C=C(CC#N)C=C1
Synonyms:- 3-Ethoxy-4-(2,2,2-trifluoroethoxy)benzeneacetonitrile
- Benzeneacetonitrile, 3-ethoxy-4-(2,2,2-trifluoroethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.