CAS 1193388-20-3

1,2-Ethanediamine, N2-cyclohexyl-N1,N1-dimethyl-, hydrochloride (1:2)

Description:

1,2-Ethanediamine, N2-cyclohexyl-N1,N1-dimethyl-, hydrochloride (1:2) is a chemical compound characterized by its amine functional groups, which contribute to its basicity and potential reactivity. This substance is a hydrochloride salt, indicating that it is formed by the reaction of the amine with hydrochloric acid, enhancing its solubility in water. The presence of cyclohexyl and dimethyl groups suggests that it has a bulky structure, which may influence its steric properties and interactions with biological systems. As a diamine, it can participate in various chemical reactions, including those involving nucleophilic substitution and coordination with metal ions. Its applications may extend to fields such as pharmaceuticals, where it could serve as an intermediate or a building block in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as amines can be hazardous, and the hydrochloride form may have specific stability and solubility characteristics.

Formula: C₁₀H₂₂N₂·2ClH

InChI: InChI=1S/C10H22N2.2ClH/c1-12(2)9-8-11-10-6-4-3-5-7-10;;/h10-11H,3-9H2,1-2H3;2*1H

InChI key: InChIKey=UNMMXAMEMXGBFP-UHFFFAOYSA-N

SMILES: N(CCN(C)C)C1CCCCC1.Cl

Synonyms:

• 1,2-Ethanediamine, N2-cyclohexyl-N1,N1-dimethyl-, hydrochloride (1:2)