CAS 1193388-23-6

1H-Imidazole-1-propanamine, β,2-dimethyl-, hydrochloride (1:2)

Description:

1H-Imidazole-1-propanamine, β,2-dimethyl-, hydrochloride (1:2) is a chemical compound characterized by its imidazole ring structure, which is a five-membered aromatic heterocycle containing two nitrogen atoms. This compound features a propanamine side chain with two methyl groups at the β and 2 positions, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the imidazole moiety suggests potential biological activity, as imidazole derivatives are often found in biologically active compounds, including certain neurotransmitters and pharmaceuticals. The compound may exhibit basic properties due to the amine group, allowing it to participate in acid-base reactions. Its specific characteristics, such as melting point, solubility, and reactivity, would depend on the conditions and the presence of other substances. Overall, this compound's structure and properties make it of interest in medicinal chemistry and related fields.

Formula: C₈H₁₅N₃·2ClH

InChI: InChI=1S/C8H15N3.2ClH/c1-7(5-9)6-11-4-3-10-8(11)2;;/h3-4,7H,5-6,9H2,1-2H3;2*1H

InChI key: InChIKey=PAMCZZYSMGLCRY-UHFFFAOYSA-N

SMILES: C(C(CN)C)N1C(C)=NC=C1.Cl

Synonyms:

• 1H-Imidazole-1-propanamine, β,2-dimethyl-, hydrochloride (1:2)

2-Methyl-3-(2-methyl-1H-imidazol-1-yl)propan-1-amine dihydrochloride

CAS: 1193388-23-6

Versatile small molecule scaffold

Formula: C₈H₁₇Cl₂N₃

Purity: Min. 95%

Molecular weight: 226.14 g/mol

Ref: 3D-TXB38823