CymitQuimica logo

CAS 1193388-24-7

:

2,5-Dimethyl-1-pyrrolidineacetic acid

Description:
2,5-Dimethyl-1-pyrrolidineacetic acid is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. This compound features two methyl groups at the 2 and 5 positions of the pyrrolidine ring, contributing to its unique steric and electronic properties. The presence of the acetic acid functional group provides acidic characteristics, allowing for potential interactions in various chemical environments. It is typically a white to off-white solid, soluble in polar solvents due to the presence of the carboxylic acid group. The compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for potential applications in medicinal chemistry, particularly in the development of drugs targeting neurological or metabolic pathways. As with many organic compounds, the stability and reactivity of 2,5-Dimethyl-1-pyrrolidineacetic acid can be influenced by environmental factors such as pH and temperature. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C8H15NO2
InChI:InChI=1S/C8H15NO2/c1-6-3-4-7(2)9(6)5-8(10)11/h6-7H,3-5H2,1-2H3,(H,10,11)
InChI key:InChIKey=OASXJQXXBOTLPU-UHFFFAOYSA-N
SMILES:C(C(O)=O)N1C(C)CCC1C
Synonyms:
  • 1-Pyrrolidineacetic acid, 2,5-dimethyl-
  • 2,5-Dimethyl-1-pyrrolidineacetic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.