
CAS 1193388-37-2
:Methyl 4-amino-2-[(2-furanylmethyl)amino]-5-thiazolecarboxylate
Description:
Methyl 4-amino-2-[(2-furanylmethyl)amino]-5-thiazolecarboxylate is a chemical compound characterized by its complex structure, which includes a thiazole ring, an amino group, and a furan moiety. This compound typically exhibits properties associated with both heterocyclic and aromatic compounds, contributing to its potential biological activity. The presence of the thiazole ring suggests that it may participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. The furan group can enhance the compound's reactivity and solubility in organic solvents. Additionally, the methyl ester functional group indicates that it may undergo hydrolysis to yield the corresponding carboxylic acid. This compound may be of interest in medicinal chemistry due to its potential pharmacological properties, which could include antimicrobial or anticancer activities, although specific biological data would be necessary to confirm such effects. Overall, Methyl 4-amino-2-[(2-furanylmethyl)amino]-5-thiazolecarboxylate represents a versatile structure with potential applications in drug development and organic synthesis.
Formula:C10H11N3O3S
InChI:InChI=1S/C10H11N3O3S/c1-15-9(14)7-8(11)13-10(17-7)12-5-6-3-2-4-16-6/h2-4H,5,11H2,1H3,(H,12,13)
InChI key:InChIKey=MDMMPWKYTPYVIU-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(N)N=C(NCC2=CC=CO2)S1
Synonyms:- Methyl 4-amino-2-[(2-furanylmethyl)amino]-5-thiazolecarboxylate
- 5-Thiazolecarboxylic acid, 4-amino-2-[(2-furanylmethyl)amino]-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.