
CAS 1193388-41-8
:1H-Imidazole-2-acetic acid, 1-methyl-, ethyl ester, hydrochloride (1:1)
Description:
1H-Imidazole-2-acetic acid, 1-methyl-, ethyl ester, hydrochloride (1:1) is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance is typically a white to off-white crystalline solid, soluble in water and polar organic solvents due to the presence of the hydrochloride salt form, which enhances its solubility. The imidazole moiety contributes to its potential biological activity, making it of interest in pharmaceutical research. The ethyl ester functional group suggests that it may exhibit ester-like properties, potentially influencing its reactivity and interaction with biological systems. The compound's hydrochloride form indicates that it is a salt, which can affect its stability and solubility profile. Overall, this compound may have applications in medicinal chemistry, particularly in the development of drugs targeting various biological pathways. However, specific biological activities and safety profiles would require further investigation through empirical studies.
Formula:C8H12N2O2.ClH
InChI:InChI=1S/C8H12N2O2.ClH/c1-3-12-8(11)6-7-9-4-5-10(7)2;/h4-5H,3,6H2,1-2H3;1H
InChI key:InChIKey=NFMPVVVZKGTNFT-UHFFFAOYSA-N
SMILES:C(C(OCC)=O)C=1N(C)C=CN1.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.