CAS 1193388-42-9
:2-(3-Cyclopropyl-1H-1,2,4-triazol-5-yl)-4-methylbenzenamine
Description:
2-(3-Cyclopropyl-1H-1,2,4-triazol-5-yl)-4-methylbenzenamine, with the CAS number 1193388-42-9, is a chemical compound characterized by its unique structural features, including a triazole ring and a cyclopropyl group. This compound typically exhibits properties associated with both aromatic amines and heterocyclic compounds, which may influence its solubility, reactivity, and potential biological activity. The presence of the triazole moiety suggests potential applications in pharmaceuticals, particularly in antifungal or antimicrobial agents, due to the biological significance of triazole derivatives. Additionally, the cyclopropyl group can enhance the compound's lipophilicity and may affect its interaction with biological targets. The methyl group on the benzene ring can also influence the electronic properties and steric hindrance of the molecule. Overall, this compound's characteristics make it a subject of interest in medicinal chemistry and material science, although specific physical and chemical properties would require empirical measurement or detailed computational analysis for precise characterization.
Formula:C12H14N4
InChI:InChI=1S/C12H14N4/c1-7-2-5-10(13)9(6-7)12-14-11(15-16-12)8-3-4-8/h2,5-6,8H,3-4,13H2,1H3,(H,14,15,16)
InChI key:InChIKey=VARILXNTLVKIIN-UHFFFAOYSA-N
SMILES:NC1=C(C=2NC(=NN2)C3CC3)C=C(C)C=C1
Synonyms:- 2-(3-Cyclopropyl-1H-1,2,4-triazol-5-yl)-4-methylbenzenamine
- Benzenamine, 2-(3-cyclopropyl-1H-1,2,4-triazol-5-yl)-4-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.