
CAS 1193388-48-5
:4-Pyridinecarboxylic acid, 2-(1H-1,2,4-triazol-1-yl)-, hydrochloride (1:1)
Description:
4-Pyridinecarboxylic acid, 2-(1H-1,2,4-triazol-1-yl)-, hydrochloride (1:1), with CAS number 1193388-48-5, is a chemical compound that features a pyridine ring substituted with a carboxylic acid group and a triazole moiety. This compound is typically characterized by its solid state, often appearing as a crystalline or powder form. The presence of the hydrochloride indicates that it is a salt formed with hydrochloric acid, which can enhance its solubility in polar solvents, particularly water. The triazole group contributes to its potential biological activity, making it of interest in pharmaceutical research, particularly for its possible applications in antifungal or antimicrobial agents. The compound's structure suggests it may exhibit various functional properties, including acidity due to the carboxylic acid group and potential coordination chemistry due to the nitrogen atoms in the triazole. Overall, this compound represents a unique combination of heterocyclic chemistry and carboxylic acid functionality, making it a subject of interest in both synthetic and medicinal chemistry.
Formula:C8H6N4O2·ClH
InChI:InChI=1S/C8H6N4O2.ClH/c13-8(14)6-1-2-10-7(3-6)12-5-9-4-11-12;/h1-5H,(H,13,14);1H
InChI key:InChIKey=MVCZAZISCIKLTE-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(N=CC1)N2C=NC=N2.Cl
Synonyms:- 4-Pyridinecarboxylic acid, 2-(1H-1,2,4-triazol-1-yl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.