CAS 1193388-53-2

Benzenepropanamine, 4-(1-methylethoxy)-, hydrochloride (1:1)

Description:

Benzenepropanamine, 4-(1-methylethoxy)-, hydrochloride (1:1), with the CAS number 1193388-53-2, is a chemical compound characterized by its amine functional group and aromatic structure. This substance features a benzene ring substituted with a propanamine group and an ethoxy group, which contributes to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the ethoxy group may influence its lipophilicity and biological activity, making it of interest in medicinal chemistry. The compound's molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic purposes. However, specific safety and handling guidelines should be followed, as with all chemical substances, to mitigate any risks associated with its use. Further studies would be necessary to fully elucidate its pharmacological profile and potential applications in drug development.

Formula: C₁₂H₁₉NO·ClH

InChI: InChI=1S/C12H19NO.ClH/c1-10(2)14-12-7-5-11(6-8-12)4-3-9-13;/h5-8,10H,3-4,9,13H2,1-2H3;1H

InChI key: InChIKey=WQGLWQOFSIUKLZ-UHFFFAOYSA-N

SMILES: O(C(C)C)C1=CC=C(CCCN)C=C1.Cl

Synonyms:

• Benzenepropanamine, 4-(1-methylethoxy)-, hydrochloride (1:1)

3-[4-(Propan-2-yloxy)phenyl]propan-1-amine hydrochloride

CAS: 1193388-53-2

Versatile small molecule scaffold

Formula: C₁₂H₂₀ClNO

Purity: Min. 95%

Molecular weight: 229.74 g/mol

Ref: 3D-TXB38853