
CAS 1193388-60-1
:Phenol, 4-[(2-aminophenyl)methyl]-, hydrochloride (1:1)
Description:
Phenol, 4-[(2-aminophenyl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its phenolic structure, which includes a hydroxyl group (-OH) attached to a benzene ring. The presence of the 2-aminophenyl group indicates that there is an amino group (-NH2) on the second carbon of a phenyl ring, contributing to its potential as a biological or pharmaceutical agent. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications. This compound may exhibit properties such as antibacterial or antifungal activity, making it of interest in medicinal chemistry. Additionally, its structure suggests potential for interactions with biological targets, which could be explored in drug development. Safety considerations are important, as phenolic compounds can be toxic and irritative. Proper handling and storage conditions should be observed to mitigate risks associated with exposure. Overall, this compound represents a unique blend of phenolic and amine functionalities, making it a subject of interest in both research and application.
Formula:C13H13NO·ClH
InChI:InChI=1S/C13H13NO.ClH/c14-13-4-2-1-3-11(13)9-10-5-7-12(15)8-6-10;/h1-8,15H,9,14H2;1H
InChI key:InChIKey=CVUDFLVTIMLZIW-UHFFFAOYSA-N
SMILES:C(C1=C(N)C=CC=C1)C2=CC=C(O)C=C2.Cl
Synonyms:- Phenol, 4-[(2-aminophenyl)methyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.