CAS 1193388-61-2

6-Butyl-5,7-dimethyl[1,2,4]triazolo[1,5-a]pyrimidine-2(1H)-thione

Description:

6-Butyl-5,7-dimethyl[1,2,4]triazolo[1,5-a]pyrimidine-2(1H)-thione is a heterocyclic compound characterized by its unique triazole and pyrimidine ring structures. This compound features a butyl group and two methyl groups, contributing to its hydrophobic properties and potential biological activity. The thione functional group (–C=S) indicates the presence of sulfur, which can influence the compound's reactivity and interactions with biological targets. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of multiple functional groups that can participate in various chemical reactions. Additionally, the compound may exhibit interesting pharmacological properties, such as antimicrobial or anti-inflammatory activities, although specific biological data would be necessary to confirm these effects. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its stability and solubility would depend on the specific conditions and solvents used. Overall, this compound represents a class of triazolopyrimidine derivatives that are of interest in both synthetic and medicinal chemistry.

Formula: C₁₁H₁₆N₄S

InChI: InChI=1S/C11H16N4S/c1-4-5-6-9-7(2)12-10-13-11(16)14-15(10)8(9)3/h4-6H2,1-3H3,(H,14,16)

InChI key: InChIKey=RWWSALCPFWNLQI-UHFFFAOYSA-N

SMILES: CC=1N2C(N=C(C)C1CCCC)=NC(=S)N2

Synonyms:

• 6-Butyl-5,7-dimethyl[1,2,4]triazolo[1,5-a]pyrimidine-2(1H)-thione
• [1,2,4]Triazolo[1,5-a]pyrimidine-2(1H)-thione, 6-butyl-5,7-dimethyl-