CAS 1193388-63-4

3-(Trifluoromethyl)thieno[3,2-b]thiophene-2-carboxylic acid

Description:

3-(Trifluoromethyl)thieno[3,2-b]thiophene-2-carboxylic acid is a heterocyclic organic compound characterized by its unique structural features, which include a thieno[3,2-b]thiophene core and a trifluoromethyl group. This compound typically exhibits a high degree of stability due to the presence of the aromatic thiophene rings, which contribute to its electronic properties. The trifluoromethyl group enhances its lipophilicity and can influence its reactivity and interaction with biological systems. As a carboxylic acid, it possesses acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. The compound's potential applications may span across materials science, organic electronics, and pharmaceuticals, particularly in the development of functional materials or as intermediates in synthetic pathways. Its unique combination of fluorinated and heterocyclic components makes it a subject of interest in research focused on novel chemical entities with specific electronic and physical properties.

Formula: C₈H₃F₃O₂S₂

InChI: InChI=1S/C8H3F3O2S2/c9-8(10,11)4-5-3(1-2-14-5)15-6(4)7(12)13/h1-2H,(H,12,13)

InChI key: InChIKey=LHUIOKSVKKVJAG-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C2=C(SC1C(O)=O)C=CS2

Synonyms:

• 3-(Trifluoromethyl)thieno[3,2-b]thiophene-2-carboxylic acid
• Thieno[3,2-b]thiophene-2-carboxylic acid, 3-(trifluoromethyl)-

3-(Trifluoromethyl)thieno[3,2-b]thiophene-2-carboxylic acid

CAS: 1193388-63-4

Versatile small molecule scaffold

Formula: C₈H₃F₃O₂S₂

Purity: Min. 95%

Molecular weight: 252.2 g/mol

Ref: 3D-TXB38863