CAS 1193388-69-0

1,4-Benzodioxin-6-methanamine, 7-bromo-2,3-dihydro-α-methyl-, hydrochloride (1:1)

Description:

1,4-Benzodioxin-6-methanamine, 7-bromo-2,3-dihydro-α-methyl-, hydrochloride (1:1) is a chemical compound characterized by its complex structure, which includes a benzodioxin core and an amine functional group. This compound typically appears as a white to off-white solid and is soluble in polar solvents, reflecting its amine and hydrochloride nature. The presence of the bromine atom introduces additional reactivity and potential for substitution reactions. As a hydrochloride salt, it is likely to exhibit enhanced stability and solubility in aqueous environments compared to its free base form. The compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can interact with biological targets. However, specific biological activity, toxicity, and safety profiles would require further investigation through empirical studies. As with many chemical substances, proper handling and safety precautions are essential, given the potential hazards associated with amines and halogenated compounds.

Formula: C₁₀H₁₂BrNO₂·ClH

InChI: InChI=1S/C10H12BrNO2.ClH/c1-6(12)7-4-9-10(5-8(7)11)14-3-2-13-9;/h4-6H,2-3,12H2,1H3;1H

InChI key: InChIKey=VYIUDZLVVLWZEY-UHFFFAOYSA-N

SMILES: C(C)(N)C=1C=C2C(=CC1Br)OCCO2.Cl

Synonyms:

• 1,4-Benzodioxin-6-methanamine, 7-bromo-2,3-dihydro-α-methyl-, hydrochloride (1:1)

1-(7-Bromo-2,3-dihydro-1,4-benzodioxin-6-yl)ethan-1-amine hydrochloride

CAS: 1193388-69-0

Versatile small molecule scaffold

Formula: C₁₀H₁₃BrClNO₂

Purity: Min. 95%

Molecular weight: 294.57 g/mol

Ref: 3D-TXB38869