CAS 1193388-78-1

1H-Indole-5-sulfonamide, 2,3-dihydro-, hydrochloride (1:1)

Description:

1H-Indole-5-sulfonamide, 2,3-dihydro-, hydrochloride (1:1) is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a sulfonamide functional group, which is known for its antibacterial properties and ability to inhibit certain enzymes. The presence of the hydrochloride indicates that the compound is in its salt form, enhancing its solubility in water and making it more suitable for biological applications. The dihydro form suggests that the compound has undergone hydrogenation, which can influence its reactivity and biological activity. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. Its specific interactions, stability, and potential therapeutic effects would depend on further studies, including its pharmacokinetics and mechanism of action. Overall, 1H-Indole-5-sulfonamide, 2,3-dihydro-, hydrochloride is a compound with potential applications in drug development and research.

Formula: C₈H₁₀N₂O₂S·ClH

InChI: InChI=1S/C8H10N2O2S.ClH/c9-13(11,12)7-1-2-8-6(5-7)3-4-10-8;/h1-2,5,10H,3-4H2,(H2,9,11,12);1H

InChI key: InChIKey=YXQKQOXLIGPUCB-UHFFFAOYSA-N

SMILES: S(N)(=O)(=O)C=1C=C2C(=CC1)NCC2.Cl

Synonyms:

• 1H-Indole-5-sulfonamide, 2,3-dihydro-, hydrochloride (1:1)