CAS 1193388-80-5

1H-1,2,4-Triazole-5-acetic acid, α-hydroxy-1-methyl-α-(1-methyl-1H-1,2,4-triazol-5-yl)-, hydrochloride (1:1)

Description:

1H-1,2,4-Triazole-5-acetic acid, α-hydroxy-1-methyl-α-(1-methyl-1H-1,2,4-triazol-5-yl)-, hydrochloride (1:1) is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features both an acetic acid moiety and a hydroxyl group, contributing to its potential as a bioactive molecule. The presence of the hydrochloride indicates that it is a salt form, which often enhances solubility in water and may influence its pharmacokinetic properties. The compound is likely to exhibit properties typical of triazole derivatives, such as antifungal or antimicrobial activity, due to the triazole ring's ability to interact with biological targets. Its specific applications and efficacy would depend on further studies, including its mechanism of action, stability, and interactions with other biological molecules. As with many triazole derivatives, it may also be of interest in agricultural or pharmaceutical contexts.

Formula: C₈H₁₀N₆O₃·ClH

InChI: InChI=1S/C8H10N6O3.ClH/c1-13-5(9-3-11-13)8(17,7(15)16)6-10-4-12-14(6)2;/h3-4,17H,1-2H3,(H,15,16);1H

InChI key: InChIKey=HMSHMZYTOITSRO-UHFFFAOYSA-N

SMILES: C(C(O)=O)(O)(C=1N(C)N=CN1)C=2N(C)N=CN2.Cl

Synonyms:

• 1H-1,2,4-Triazole-5-acetic acid, α-hydroxy-1-methyl-α-(1-methyl-1H-1,2,4-triazol-5-yl)-, hydrochloride (1:1)