CAS 1193388-90-7

Propanamide, 3-amino-N-(4-bromophenyl)-, hydrochloride (1:1)

Description:

Propanamide, 3-amino-N-(4-bromophenyl)-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is derived from propanoic acid. The presence of the amino group indicates that it possesses basic properties, while the 4-bromophenyl substituent suggests potential for aromatic interactions and reactivity due to the bromine atom's electronegative nature. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in biological and pharmaceutical applications. The compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure allows for potential interactions with biological targets, which could be explored in drug design. Safety and handling precautions should be observed, as with all chemical substances, particularly those with halogen substituents, due to potential toxicity and environmental impact. Overall, this compound represents a specific class of organic molecules with diverse applications in research and industry.

Formula: C₉H₁₁BrN₂O·ClH

InChI: InChI=1S/C9H11BrN2O.ClH/c10-7-1-3-8(4-2-7)12-9(13)5-6-11;/h1-4H,5-6,11H2,(H,12,13);1H

InChI key: InChIKey=XNTHPUDCCNQKNU-UHFFFAOYSA-N

SMILES: N(C(CCN)=O)C1=CC=C(Br)C=C1.Cl

Synonyms:

• Propanamide, 3-amino-N-(4-bromophenyl)-, hydrochloride (1:1)

3-amino-N-(4-bromophenyl)propanamide hydrochloride

CAS: 1193388-90-7

Formula: C₉H₁₂BrClN₂O

Purity: 95.0%

Molecular weight: 279.56

Ref: 10-F496167