CymitQuimica logo

CAS 1193388-91-8

:

2-Methoxy-4,6-dimethyl-3-pyridinecarbothioamide

Description:
2-Methoxy-4,6-dimethyl-3-pyridinecarbothioamide is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features a methoxy group (-OCH3) and two methyl groups (-CH3) at the 4 and 6 positions of the pyridine ring, contributing to its overall hydrophobic character. The presence of the carbothioamide functional group (-C(S)NH2) at the 3-position enhances its reactivity, particularly in nucleophilic substitution reactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its solubility properties are influenced by the polar methoxy group and the overall structure, which can affect its interaction with biological systems. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 2-Methoxy-4,6-dimethyl-3-pyridinecarbothioamide is a versatile compound with potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C9H12N2OS
InChI:InChI=1S/C9H12N2OS/c1-5-4-6(2)11-9(12-3)7(5)8(10)13/h4H,1-3H3,(H2,10,13)
InChI key:InChIKey=OIYGRDBXNDSMJW-UHFFFAOYSA-N
SMILES:O(C)C1=C(C(N)=S)C(C)=CC(C)=N1
Synonyms:
  • 2-Methoxy-4,6-dimethyl-3-pyridinecarbothioamide
  • 3-Pyridinecarbothioamide, 2-methoxy-4,6-dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.