CAS 1193388-95-2

1,3-Dimethyl-1H-pyrazolo[3,4-b]pyridine-5-carbothioamide

Description:

1,3-Dimethyl-1H-pyrazolo[3,4-b]pyridine-5-carbothioamide is a heterocyclic compound characterized by its unique pyrazolo-pyridine structure, which incorporates both pyrazole and pyridine rings. This compound features two methyl groups at the 1 and 3 positions of the pyrazole ring, enhancing its lipophilicity and potentially influencing its biological activity. The presence of a carbothioamide functional group at the 5-position contributes to its reactivity and may play a role in its interactions with biological targets. This compound is of interest in medicinal chemistry due to its potential pharmacological properties, including anti-inflammatory and anticancer activities. Its solubility and stability can vary depending on the solvent and environmental conditions, which are important factors for its application in research and development. As with many heterocyclic compounds, the electronic properties and steric effects of the substituents can significantly influence its chemical behavior and biological interactions. Further studies are often required to fully elucidate its mechanisms of action and potential therapeutic applications.

Formula: C₉H₁₀N₄S

InChI: InChI=1S/C9H10N4S/c1-5-7-3-6(8(10)14)4-11-9(7)13(2)12-5/h3-4H,1-2H3,(H2,10,14)

InChI key: InChIKey=IMLCQCKFQLEOIZ-UHFFFAOYSA-N

SMILES: CC=1C=2C(N(C)N1)=NC=C(C(N)=S)C2

Synonyms:

• 1H-Pyrazolo[3,4-b]pyridine-5-carbothioamide, 1,3-dimethyl-
• 1,3-Dimethyl-1H-pyrazolo[3,4-b]pyridine-5-carbothioamide