CAS 1193388-97-4

1-(1,1-Dimethylethyl) 4-phenoxy-1,4-piperidinedicarboxylate

Description:

1-(1,1-Dimethylethyl) 4-phenoxy-1,4-piperidinedicarboxylate, identified by its CAS number 1193388-97-4, is a chemical compound characterized by its complex structure, which includes a piperidine ring substituted with both a phenoxy group and a tert-butyl group. This compound typically exhibits properties associated with both lipophilicity and potential biological activity, making it of interest in pharmaceutical research. The presence of the piperidine moiety suggests potential interactions with biological targets, particularly in the central nervous system. Its ester functional groups may influence its solubility and reactivity, impacting its pharmacokinetic properties. Additionally, the tert-butyl group contributes to steric hindrance, which can affect the compound's binding affinity to receptors or enzymes. Overall, this compound's unique structural features may confer specific therapeutic properties, warranting further investigation in medicinal chemistry and drug development contexts.

Formula: C₁₇H₂₃NO₅

InChI: InChI=1S/C17H23NO5/c1-16(2,3)23-15(21)18-11-9-17(10-12-18,14(19)20)22-13-7-5-4-6-8-13/h4-8H,9-12H2,1-3H3,(H,19,20)

InChI key: InChIKey=HXFOWFRUWADNAQ-UHFFFAOYSA-N

SMILES: O(C1(C(O)=O)CCN(C(OC(C)(C)C)=O)CC1)C2=CC=CC=C2

Synonyms:

• 1-(1,1-Dimethylethyl) 4-phenoxy-1,4-piperidinedicarboxylate
• 1,4-Piperidinedicarboxylic acid, 4-phenoxy-, 1-(1,1-dimethylethyl) ester
• 1-[(tert-Butoxy)carbonyl]-4-phenoxypiperidine-4-carboxylic acid

1-[(tert-Butoxy)carbonyl]-4-phenoxypiperidine-4-carboxylic acid

CAS: 1193388-97-4

Versatile small molecule scaffold

Formula: C₁₇H₂₃NO₅

Purity: Min. 95%

Molecular weight: 321.4 g/mol

Ref: 3D-TXB38897