
CAS 1193388-98-5
:3-(Aminomethyl)-2-methylpyrazolo[5,1-b]quinazolin-9(4H)-one
Description:
3-(Aminomethyl)-2-methylpyrazolo[5,1-b]quinazolin-9(4H)-one is a heterocyclic organic compound characterized by its complex structure, which includes a pyrazoloquinazolinone framework. This compound features an aminomethyl group and a methyl substituent, contributing to its unique chemical properties. It is typically classified as a bioactive molecule, often investigated for its potential pharmacological applications, particularly in the fields of medicinal chemistry and drug development. The presence of the pyrazolo and quinazolinone moieties suggests potential interactions with biological targets, making it a candidate for further research in therapeutic contexts. Additionally, the compound's solubility, stability, and reactivity can be influenced by its functional groups, which may affect its biological activity and efficacy. As with many heterocycles, the compound may exhibit interesting electronic properties due to the delocalization of electrons within its aromatic systems. Overall, 3-(Aminomethyl)-2-methylpyrazolo[5,1-b]quinazolin-9(4H)-one represents a significant structure for exploration in chemical and pharmaceutical research.
Formula:C12H12N4O
InChI:InChI=1S/C12H12N4O/c1-7-9(6-13)11-14-10-5-3-2-4-8(10)12(17)16(11)15-7/h2-5,14H,6,13H2,1H3
InChI key:InChIKey=IISVDZJPHFTTMA-UHFFFAOYSA-N
SMILES:C(N)C1=C2N(C(=O)C=3C(N2)=CC=CC3)N=C1C
Synonyms:- 3-(Aminomethyl)-2-methylpyrazolo[5,1-b]quinazolin-9(4H)-one
- Pyrazolo[5,1-b]quinazolin-9(4H)-one, 3-(aminomethyl)-2-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.