CAS 1193389-03-5

1H-Benzimidazol-6-amine, 2-(2-furanyl)-, hydrochloride (1:1)

Description:

1H-Benzimidazol-6-amine, 2-(2-furanyl)-, hydrochloride (1:1) is a chemical compound characterized by its benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. The presence of a furanyl group, derived from furan, introduces additional reactivity and potential for various interactions, making it of interest in medicinal chemistry. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its bioavailability for pharmaceutical applications. The compound may exhibit biological activity, potentially acting as an inhibitor or modulator in various biochemical pathways. Its molecular structure suggests potential applications in drug development, particularly in areas targeting specific receptors or enzymes. The compound's properties, such as melting point, solubility, and stability, can vary based on environmental conditions and formulation. Safety and handling precautions are essential, as with any chemical substance, to mitigate risks associated with exposure or reaction with other materials.

Formula: C₁₁H₉N₃O·ClH

InChI: InChI=1S/C11H9N3O.ClH/c12-7-3-4-8-9(6-7)14-11(13-8)10-2-1-5-15-10;/h1-6H,12H2,(H,13,14);1H

InChI key: InChIKey=YRYZAWXRQJGIHW-UHFFFAOYSA-N

SMILES: NC=1C=C2N=C(NC2=CC1)C3=CC=CO3.Cl

Synonyms:

• 1H-Benzimidazol-6-amine, 2-(2-furanyl)-, hydrochloride (1:1)